C20H20O2 — CID 158678637
(4E)-1,5-diphenylpenta-1,4-dien-3-one;propan-2-one (PubChem CID 158678637) has the molecular formula C20H20O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is (4E)-1,5-diphenylpenta-1,4-dien-3-one;propan-2-one.
| Compound Name | (4E)-1,5-diphenylpenta-1,4-dien-3-one;propan-2-one |
|---|---|
| PubChem CID | 158678637 |
| Molecular Formula | C20H20O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | (4E)-1,5-diphenylpenta-1,4-dien-3-one;propan-2-one |
| SMILES | CC(C)=O.O=C(C=Cc1ccccc1)/C=C/c1ccccc1 |
| InChI | InChI=1S/C17H14O.C3H6O/c18-17(13-11-15-7-3-1-4-8-15)14-12-16-9-5-2-6-10-16;1-3(2)4/h1-14H;1-2H3/b13-11+,14-12?; |
| InChIKey | IEVKGPDBCXTSEZ-SKSLGULKSA-N |
| XLogP | 4.58 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|