C25H22O2 — CID 160723303
(1E,4E)-1,5-diphenylpenta-1,4-dien-3-one;1-phenylethanone (PubChem CID 160723303) has the molecular formula C25H22O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is (1E,4E)-1,5-diphenylpenta-1,4-dien-3-one;1-phenylethanone.
| Compound Name | (1E,4E)-1,5-diphenylpenta-1,4-dien-3-one;1-phenylethanone |
|---|---|
| PubChem CID | 160723303 |
| Molecular Formula | C25H22O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | (1E,4E)-1,5-diphenylpenta-1,4-dien-3-one;1-phenylethanone |
| SMILES | CC(=O)c1ccccc1.O=C(/C=C/c1ccccc1)/C=C/c1ccccc1 |
| InChI | InChI=1S/C17H14O.C8H8O/c18-17(13-11-15-7-3-1-4-8-15)14-12-16-9-5-2-6-10-16;1-7(9)8-5-3-2-4-6-8/h1-14H;2-6H,1H3/b13-11+,14-12+; |
| InChIKey | RTJNCRZXGSMVRK-JZOPPWQGSA-N |
| XLogP | 5.87 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|