C16H16O — CID 90871438
1-(cyclotetradecaheptaenyl)ethanone (PubChem CID 90871438) has the molecular formula C16H16O and a molecular weight of 224.30 g/mol. Its IUPAC name is 1-(cyclotetradecaheptaenyl)ethanone.
| Compound Name | 1-(cyclotetradecaheptaenyl)ethanone |
|---|---|
| PubChem CID | 90871438 |
| Molecular Formula | C16H16O |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 1-(cyclotetradecaheptaenyl)ethanone |
| SMILES | CC(=O)c1ccccccccccccc1 |
| InChI | InChI=1S/C16H16O/c1-15(17)16-13-11-9-7-5-3-2-4-6-8-10-12-14-16/h2-14H,1H3/b3-2-,4-2+,5-3-,6-4+,7-5+,8-6-,9-7+,10-8+,11-9-,12-10+,13-11+,14-12-,16-13-,16-14+ |
| InChIKey | QVHKOTKBCWXVDI-ZESBLDQKSA-N |
| XLogP | 4.14 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |