About CID 22025249
CID 22025249 (PubChem CID 22025249) has the molecular formula C8H8O2Si2
and a molecular weight of 192.32 g/mol.
Molecular Properties
| Compound Name | CID 22025249 |
| PubChem CID | 22025249 |
| Molecular Formula | C8H8O2Si2 |
| Molecular Weight | 192.32 g/mol |
| Exact Mass | 192.01 |
| IUPAC Name | — |
| SMILES | CC(=O)c1ccccc1.[Si]O[Si] |
| InChI | InChI=1S/C8H8O.OSi2/c1-7(9)8-5-3-2-4-6-8;2-1-3/h2-6H,1H3; |
| InChIKey | NJKBDYBQMJRYJW-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.32 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 22025249 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 22025249?
The IUPAC name of CID 22025249 (CID 22025249) is not available.
What is the SMILES notation for CID 22025249?
The canonical SMILES for CID 22025249 is CC(=O)c1ccccc1.[Si]O[Si].
What is the InChIKey of CID 22025249?
The InChIKey is NJKBDYBQMJRYJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O.OSi2/c1-7(9)8-5-3-2-4-6-8;2-1-3/h2-6H,1H3;.
What are the key properties of CID 22025249?
CID 22025249 has a molecular weight of 192.32 g/mol, XLogP of 1.06, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 22025249 is sourced from PubChem (CID 22025249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).