About benzoyl benzenecarboperoxoate;1-phenylethanone
benzoyl benzenecarboperoxoate;1-phenylethanone (PubChem CID 158043567) has the molecular formula C22H18O5
and a molecular weight of 362.38 g/mol. Its IUPAC name is benzoyl benzenecarboperoxoate;1-phenylethanone.
Molecular Properties
| Compound Name | benzoyl benzenecarboperoxoate;1-phenylethanone |
| PubChem CID | 158043567 |
| Molecular Formula | C22H18O5 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | benzoyl benzenecarboperoxoate;1-phenylethanone |
| SMILES | CC(=O)c1ccccc1.O=C(OOC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H10O4.C8H8O/c15-13(11-7-3-1-4-8-11)17-18-14(16)12-9-5-2-6-10-12;1-7(9)8-5-3-2-4-6-8/h1-10H;2-6H,1H3 |
| InChIKey | FIQJQYCRBJSMNQ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze benzoyl benzenecarboperoxoate;1-phenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzoyl benzenecarboperoxoate;1-phenylethanone?
The IUPAC name of benzoyl benzenecarboperoxoate;1-phenylethanone (CID 158043567) is benzoyl benzenecarboperoxoate;1-phenylethanone.
What is the SMILES notation for benzoyl benzenecarboperoxoate;1-phenylethanone?
The canonical SMILES for benzoyl benzenecarboperoxoate;1-phenylethanone is CC(=O)c1ccccc1.O=C(OOC(=O)c1ccccc1)c1ccccc1.
What is the InChIKey of benzoyl benzenecarboperoxoate;1-phenylethanone?
The InChIKey is FIQJQYCRBJSMNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10O4.C8H8O/c15-13(11-7-3-1-4-8-11)17-18-14(16)12-9-5-2-6-10-12;1-7(9)8-5-3-2-4-6-8/h1-10H;2-6H,1H3.
What are the key properties of benzoyl benzenecarboperoxoate;1-phenylethanone?
benzoyl benzenecarboperoxoate;1-phenylethanone has a molecular weight of 362.38 g/mol, XLogP of 4.50, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzoyl benzenecarboperoxoate;1-phenylethanone is sourced from PubChem (CID 158043567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).