About 1-phenylethanone;hydrate;hydrochloride
1-phenylethanone;hydrate;hydrochloride (PubChem CID 21258111) has the molecular formula C8H11ClO2
and a molecular weight of 174.63 g/mol. Its IUPAC name is 1-phenylethanone;hydrate;hydrochloride.
Molecular Properties
| Compound Name | 1-phenylethanone;hydrate;hydrochloride |
| PubChem CID | 21258111 |
| Molecular Formula | C8H11ClO2 |
| Molecular Weight | 174.63 g/mol |
| Exact Mass | 174.04 |
| IUPAC Name | 1-phenylethanone;hydrate;hydrochloride |
| SMILES | CC(=O)c1ccccc1.Cl.O |
| InChI | InChI=1S/C8H8O.ClH.H2O/c1-7(9)8-5-3-2-4-6-8;;/h2-6H,1H3;1H;1H2 |
| InChIKey | BBEMABSRXGMUAP-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 48.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.63 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-phenylethanone;hydrate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylethanone;hydrate;hydrochloride?
The IUPAC name of 1-phenylethanone;hydrate;hydrochloride (CID 21258111) is 1-phenylethanone;hydrate;hydrochloride.
What is the SMILES notation for 1-phenylethanone;hydrate;hydrochloride?
The canonical SMILES for 1-phenylethanone;hydrate;hydrochloride is CC(=O)c1ccccc1.Cl.O.
What is the InChIKey of 1-phenylethanone;hydrate;hydrochloride?
The InChIKey is BBEMABSRXGMUAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O.ClH.H2O/c1-7(9)8-5-3-2-4-6-8;;/h2-6H,1H3;1H;1H2.
What are the key properties of 1-phenylethanone;hydrate;hydrochloride?
1-phenylethanone;hydrate;hydrochloride has a molecular weight of 174.63 g/mol, XLogP of 1.49, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylethanone;hydrate;hydrochloride is sourced from PubChem (CID 21258111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).