About ethane;molecular hydrogen;1-phenylethanone
ethane;molecular hydrogen;1-phenylethanone (PubChem CID 143067772) has the molecular formula C10H16O
and a molecular weight of 152.24 g/mol. Its IUPAC name is ethane;molecular hydrogen;1-phenylethanone.
Molecular Properties
| Compound Name | ethane;molecular hydrogen;1-phenylethanone |
| PubChem CID | 143067772 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | ethane;molecular hydrogen;1-phenylethanone |
| SMILES | CC.CC(=O)c1ccccc1.[H][H] |
| InChI | InChI=1S/C8H8O.C2H6.H2/c1-7(9)8-5-3-2-4-6-8;1-2;/h2-6H,1H3;1-2H3;1H |
| InChIKey | UVFRGEDFZFNUKA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;molecular hydrogen;1-phenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;molecular hydrogen;1-phenylethanone?
The IUPAC name of ethane;molecular hydrogen;1-phenylethanone (CID 143067772) is ethane;molecular hydrogen;1-phenylethanone.
What is the SMILES notation for ethane;molecular hydrogen;1-phenylethanone?
The canonical SMILES for ethane;molecular hydrogen;1-phenylethanone is CC.CC(=O)c1ccccc1.[H][H].
What is the InChIKey of ethane;molecular hydrogen;1-phenylethanone?
The InChIKey is UVFRGEDFZFNUKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O.C2H6.H2/c1-7(9)8-5-3-2-4-6-8;1-2;/h2-6H,1H3;1-2H3;1H.
What are the key properties of ethane;molecular hydrogen;1-phenylethanone?
ethane;molecular hydrogen;1-phenylethanone has a molecular weight of 152.24 g/mol, XLogP of 3.16, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;molecular hydrogen;1-phenylethanone is sourced from PubChem (CID 143067772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).