About potassium 1-phenylethanone
potassium 1-phenylethanone (PubChem CID 19980201) has the molecular formula C8H8KO+
and a molecular weight of 159.25 g/mol. Its IUPAC name is potassium 1-phenylethanone.
Molecular Properties
| Compound Name | potassium 1-phenylethanone |
| PubChem CID | 19980201 |
| Molecular Formula | C8H8KO+ |
| Molecular Weight | 159.25 g/mol |
| Exact Mass | 159.02 |
| IUPAC Name | potassium 1-phenylethanone |
| SMILES | CC(=O)c1ccccc1.[K+] |
| InChI | InChI=1S/C8H8O.K/c1-7(9)8-5-3-2-4-6-8;/h2-6H,1H3;/q;+1 |
| InChIKey | WGYWYIIBPRMGGJ-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.25 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze potassium 1-phenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 1-phenylethanone?
The IUPAC name of potassium 1-phenylethanone (CID 19980201) is potassium 1-phenylethanone.
What is the SMILES notation for potassium 1-phenylethanone?
The canonical SMILES for potassium 1-phenylethanone is CC(=O)c1ccccc1.[K+].
What is the InChIKey of potassium 1-phenylethanone?
The InChIKey is WGYWYIIBPRMGGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O.K/c1-7(9)8-5-3-2-4-6-8;/h2-6H,1H3;/q;+1.
What are the key properties of potassium 1-phenylethanone?
potassium 1-phenylethanone has a molecular weight of 159.25 g/mol, XLogP of -1.11, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 1-phenylethanone is sourced from PubChem (CID 19980201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).