About acetonitrile;1-phenylethanone
acetonitrile;1-phenylethanone (PubChem CID 67822280) has the molecular formula C10H11NO
and a molecular weight of 161.20 g/mol. Its IUPAC name is acetonitrile;1-phenylethanone.
Molecular Properties
| Compound Name | acetonitrile;1-phenylethanone |
| PubChem CID | 67822280 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | acetonitrile;1-phenylethanone |
| SMILES | CC#N.CC(=O)c1ccccc1 |
| InChI | InChI=1S/C8H8O.C2H3N/c1-7(9)8-5-3-2-4-6-8;1-2-3/h2-6H,1H3;1H3 |
| InChIKey | GPYJCXUKXCLCDF-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze acetonitrile;1-phenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;1-phenylethanone?
The IUPAC name of acetonitrile;1-phenylethanone (CID 67822280) is acetonitrile;1-phenylethanone.
What is the SMILES notation for acetonitrile;1-phenylethanone?
The canonical SMILES for acetonitrile;1-phenylethanone is CC#N.CC(=O)c1ccccc1.
What is the InChIKey of acetonitrile;1-phenylethanone?
The InChIKey is GPYJCXUKXCLCDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O.C2H3N/c1-7(9)8-5-3-2-4-6-8;1-2-3/h2-6H,1H3;1H3.
What are the key properties of acetonitrile;1-phenylethanone?
acetonitrile;1-phenylethanone has a molecular weight of 161.20 g/mol, XLogP of 2.42, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;1-phenylethanone is sourced from PubChem (CID 67822280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).