C12H10O3 — CID 14270149
(2E,5E)-4-oxo-6-phenylhexa-2,5-dienoic acid (PubChem CID 14270149) has the molecular formula C12H10O3 and a molecular weight of 202.21 g/mol. Its IUPAC name is (2E,5E)-4-oxo-6-phenylhexa-2,5-dienoic acid.
| Compound Name | (2E,5E)-4-oxo-6-phenylhexa-2,5-dienoic acid |
|---|---|
| PubChem CID | 14270149 |
| Molecular Formula | C12H10O3 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | (2E,5E)-4-oxo-6-phenylhexa-2,5-dienoic acid |
| SMILES | O=C(O)/C=C/C(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C12H10O3/c13-11(8-9-12(14)15)7-6-10-4-2-1-3-5-10/h1-9H,(H,14,15)/b7-6+,9-8+ |
| InChIKey | LOIBKEDMTCRKRC-BLHCBFLLSA-N |
| XLogP | 1.91 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|