About 3-methylbutan-2-yl (E)-3-phenylprop-2-enoate
3-methylbutan-2-yl (E)-3-phenylprop-2-enoate (PubChem CID 166681148) has the molecular formula C14H18O2
and a molecular weight of 218.30 g/mol. Its IUPAC name is 3-methylbutan-2-yl (E)-3-phenylprop-2-enoate.
Molecular Properties
| Compound Name | 3-methylbutan-2-yl (E)-3-phenylprop-2-enoate |
| PubChem CID | 166681148 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 3-methylbutan-2-yl (E)-3-phenylprop-2-enoate |
| SMILES | CC(C)C(C)OC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C14H18O2/c1-11(2)12(3)16-14(15)10-9-13-7-5-4-6-8-13/h4-12H,1-3H3/b10-9+ |
| InChIKey | UYEONFDQIKLPFV-MDZDMXLPSA-N |
| XLogP | 3.29 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbutan-2-yl (E)-3-phenylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutan-2-yl (E)-3-phenylprop-2-enoate?
The IUPAC name of 3-methylbutan-2-yl (E)-3-phenylprop-2-enoate (CID 166681148) is 3-methylbutan-2-yl (E)-3-phenylprop-2-enoate.
What is the SMILES notation for 3-methylbutan-2-yl (E)-3-phenylprop-2-enoate?
The canonical SMILES for 3-methylbutan-2-yl (E)-3-phenylprop-2-enoate is CC(C)C(C)OC(=O)/C=C/c1ccccc1.
What is the InChIKey of 3-methylbutan-2-yl (E)-3-phenylprop-2-enoate?
The InChIKey is UYEONFDQIKLPFV-MDZDMXLPSA-N. The full InChI is InChI=1S/C14H18O2/c1-11(2)12(3)16-14(15)10-9-13-7-5-4-6-8-13/h4-12H,1-3H3/b10-9+.
What are the key properties of 3-methylbutan-2-yl (E)-3-phenylprop-2-enoate?
3-methylbutan-2-yl (E)-3-phenylprop-2-enoate has a molecular weight of 218.30 g/mol, XLogP of 3.29, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutan-2-yl (E)-3-phenylprop-2-enoate is sourced from PubChem (CID 166681148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).