C20H28O4 — CID 69305655
propan-2-yl 3,3-dimethyl-2-[1-(3-phenylprop-2-enoyloxy)ethyl]butanoate (PubChem CID 69305655) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is propan-2-yl 3,3-dimethyl-2-[1-(3-phenylprop-2-enoyloxy)ethyl]butanoate.
| Compound Name | propan-2-yl 3,3-dimethyl-2-[1-(3-phenylprop-2-enoyloxy)ethyl]butanoate |
|---|---|
| PubChem CID | 69305655 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | propan-2-yl 3,3-dimethyl-2-[1-(3-phenylprop-2-enoyloxy)ethyl]butanoate |
| SMILES | CC(C)OC(=O)C(C(C)OC(=O)C=Cc1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C20H28O4/c1-14(2)23-19(22)18(20(4,5)6)15(3)24-17(21)13-12-16-10-8-7-9-11-16/h7-15,18H,1-6H3 |
| InChIKey | PGHVNEJILUHFLZ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|