About diaminomethyl 3-phenylprop-2-enoate
diaminomethyl 3-phenylprop-2-enoate (PubChem CID 59346009) has the molecular formula C10H12N2O2
and a molecular weight of 192.22 g/mol. Its IUPAC name is diaminomethyl 3-phenylprop-2-enoate.
Molecular Properties
| Compound Name | diaminomethyl 3-phenylprop-2-enoate |
| PubChem CID | 59346009 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | diaminomethyl 3-phenylprop-2-enoate |
| SMILES | NC(N)OC(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C10H12N2O2/c11-10(12)14-9(13)7-6-8-4-2-1-3-5-8/h1-7,10H,11-12H2 |
| InChIKey | BYYJQJPOVIENRX-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze diaminomethyl 3-phenylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diaminomethyl 3-phenylprop-2-enoate?
The IUPAC name of diaminomethyl 3-phenylprop-2-enoate (CID 59346009) is diaminomethyl 3-phenylprop-2-enoate.
What is the SMILES notation for diaminomethyl 3-phenylprop-2-enoate?
The canonical SMILES for diaminomethyl 3-phenylprop-2-enoate is NC(N)OC(=O)C=Cc1ccccc1.
What is the InChIKey of diaminomethyl 3-phenylprop-2-enoate?
The InChIKey is BYYJQJPOVIENRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O2/c11-10(12)14-9(13)7-6-8-4-2-1-3-5-8/h1-7,10H,11-12H2.
What are the key properties of diaminomethyl 3-phenylprop-2-enoate?
diaminomethyl 3-phenylprop-2-enoate has a molecular weight of 192.22 g/mol, XLogP of 0.44, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diaminomethyl 3-phenylprop-2-enoate is sourced from PubChem (CID 59346009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).