About 1-chloropropyl (E)-3-phenylprop-2-enoate
1-chloropropyl (E)-3-phenylprop-2-enoate (PubChem CID 19931493) has the molecular formula C12H13ClO2
and a molecular weight of 224.69 g/mol. Its IUPAC name is 1-chloropropyl (E)-3-phenylprop-2-enoate.
Molecular Properties
| Compound Name | 1-chloropropyl (E)-3-phenylprop-2-enoate |
| PubChem CID | 19931493 |
| Molecular Formula | C12H13ClO2 |
| Molecular Weight | 224.69 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 1-chloropropyl (E)-3-phenylprop-2-enoate |
| SMILES | CCC(Cl)OC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C12H13ClO2/c1-2-11(13)15-12(14)9-8-10-6-4-3-5-7-10/h3-9,11H,2H2,1H3/b9-8+ |
| InChIKey | ICCXKQADZZCOQX-CMDGGOBGSA-N |
| XLogP | 3.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.69 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-chloropropyl (E)-3-phenylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloropropyl (E)-3-phenylprop-2-enoate?
The IUPAC name of 1-chloropropyl (E)-3-phenylprop-2-enoate (CID 19931493) is 1-chloropropyl (E)-3-phenylprop-2-enoate.
What is the SMILES notation for 1-chloropropyl (E)-3-phenylprop-2-enoate?
The canonical SMILES for 1-chloropropyl (E)-3-phenylprop-2-enoate is CCC(Cl)OC(=O)/C=C/c1ccccc1.
What is the InChIKey of 1-chloropropyl (E)-3-phenylprop-2-enoate?
The InChIKey is ICCXKQADZZCOQX-CMDGGOBGSA-N. The full InChI is InChI=1S/C12H13ClO2/c1-2-11(13)15-12(14)9-8-10-6-4-3-5-7-10/h3-9,11H,2H2,1H3/b9-8+.
What are the key properties of 1-chloropropyl (E)-3-phenylprop-2-enoate?
1-chloropropyl (E)-3-phenylprop-2-enoate has a molecular weight of 224.69 g/mol, XLogP of 3.22, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloropropyl (E)-3-phenylprop-2-enoate is sourced from PubChem (CID 19931493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).