About difluoromethyl 3-phenylprop-2-enoate
difluoromethyl 3-phenylprop-2-enoate (PubChem CID 175215356) has the molecular formula C10H8F2O2
and a molecular weight of 198.17 g/mol. Its IUPAC name is difluoromethyl 3-phenylprop-2-enoate.
Molecular Properties
| Compound Name | difluoromethyl 3-phenylprop-2-enoate |
| PubChem CID | 175215356 |
| Molecular Formula | C10H8F2O2 |
| Molecular Weight | 198.17 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | difluoromethyl 3-phenylprop-2-enoate |
| SMILES | O=C(C=Cc1ccccc1)OC(F)F |
| InChI | InChI=1S/C10H8F2O2/c11-10(12)14-9(13)7-6-8-4-2-1-3-5-8/h1-7,10H |
| InChIKey | SIALIEPDLZYYSM-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.17 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze difluoromethyl 3-phenylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of difluoromethyl 3-phenylprop-2-enoate?
The IUPAC name of difluoromethyl 3-phenylprop-2-enoate (CID 175215356) is difluoromethyl 3-phenylprop-2-enoate.
What is the SMILES notation for difluoromethyl 3-phenylprop-2-enoate?
The canonical SMILES for difluoromethyl 3-phenylprop-2-enoate is O=C(C=Cc1ccccc1)OC(F)F.
What is the InChIKey of difluoromethyl 3-phenylprop-2-enoate?
The InChIKey is SIALIEPDLZYYSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F2O2/c11-10(12)14-9(13)7-6-8-4-2-1-3-5-8/h1-7,10H.
What are the key properties of difluoromethyl 3-phenylprop-2-enoate?
difluoromethyl 3-phenylprop-2-enoate has a molecular weight of 198.17 g/mol, XLogP of 2.47, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for difluoromethyl 3-phenylprop-2-enoate is sourced from PubChem (CID 175215356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).