C24H22O8 — CID 10343064
dimethyl (2R,3R)-2,3-bis[[(E)-3-phenylprop-2-enoyl]oxy]butanedioate (PubChem CID 10343064) has the molecular formula C24H22O8 and a molecular weight of 438.43 g/mol. Its IUPAC name is dimethyl (2R,3R)-2,3-bis[[(E)-3-phenylprop-2-enoyl]oxy]butanedioate.
| Compound Name | dimethyl (2R,3R)-2,3-bis[[(E)-3-phenylprop-2-enoyl]oxy]butanedioate |
|---|---|
| PubChem CID | 10343064 |
| Molecular Formula | C24H22O8 |
| Molecular Weight | 438.43 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | dimethyl (2R,3R)-2,3-bis[[(E)-3-phenylprop-2-enoyl]oxy]butanedioate |
| SMILES | COC(=O)[C@H](OC(=O)/C=C/c1ccccc1)[C@@H](OC(=O)/C=C/c1ccccc1)C(=O)OC |
| InChI | InChI=1S/C24H22O8/c1-29-23(27)21(31-19(25)15-13-17-9-5-3-6-10-17)22(24(28)30-2)32-20(26)16-14-18-11-7-4-8-12-18/h3-16,21-22H,1-2H3/b15-13+,16-14+/t21-,22-/m1/s1 |
| InChIKey | JZTNONPQMDYWTO-UDVIYJLQSA-N |
| XLogP | 2.58 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|