About lanthanum;(E)-3-phenylprop-2-eneperoxoic acid
lanthanum;(E)-3-phenylprop-2-eneperoxoic acid (PubChem CID 122589716) has the molecular formula C9H8LaO3
and a molecular weight of 303.07 g/mol. Its IUPAC name is lanthanum;(E)-3-phenylprop-2-eneperoxoic acid.
Molecular Properties
| Compound Name | lanthanum;(E)-3-phenylprop-2-eneperoxoic acid |
| PubChem CID | 122589716 |
| Molecular Formula | C9H8LaO3 |
| Molecular Weight | 303.07 g/mol |
| Exact Mass | 302.95 |
| IUPAC Name | lanthanum;(E)-3-phenylprop-2-eneperoxoic acid |
| SMILES | O=C(/C=C/c1ccccc1)OO.[La] |
| InChI | InChI=1S/C9H8O3.La/c10-9(12-11)7-6-8-4-2-1-3-5-8;/h1-7,11H;/b7-6+; |
| InChIKey | AFAOMKHRWYTGMJ-UHDJGPCESA-N |
| XLogP | 1.72 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.07 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze lanthanum;(E)-3-phenylprop-2-eneperoxoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lanthanum;(E)-3-phenylprop-2-eneperoxoic acid?
The IUPAC name of lanthanum;(E)-3-phenylprop-2-eneperoxoic acid (CID 122589716) is lanthanum;(E)-3-phenylprop-2-eneperoxoic acid.
What is the SMILES notation for lanthanum;(E)-3-phenylprop-2-eneperoxoic acid?
The canonical SMILES for lanthanum;(E)-3-phenylprop-2-eneperoxoic acid is O=C(/C=C/c1ccccc1)OO.[La].
What is the InChIKey of lanthanum;(E)-3-phenylprop-2-eneperoxoic acid?
The InChIKey is AFAOMKHRWYTGMJ-UHDJGPCESA-N. The full InChI is InChI=1S/C9H8O3.La/c10-9(12-11)7-6-8-4-2-1-3-5-8;/h1-7,11H;/b7-6+;.
What are the key properties of lanthanum;(E)-3-phenylprop-2-eneperoxoic acid?
lanthanum;(E)-3-phenylprop-2-eneperoxoic acid has a molecular weight of 303.07 g/mol, XLogP of 1.72, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lanthanum;(E)-3-phenylprop-2-eneperoxoic acid is sourced from PubChem (CID 122589716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).