C23H18O3 — CID 776025
[(1R)-2-oxo-1,2-diphenylethyl] (E)-3-phenylprop-2-enoate (PubChem CID 776025) has the molecular formula C23H18O3 and a molecular weight of 342.39 g/mol. Its IUPAC name is [(1R)-2-oxo-1,2-diphenylethyl] (E)-3-phenylprop-2-enoate.
| Compound Name | [(1R)-2-oxo-1,2-diphenylethyl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 776025 |
| Molecular Formula | C23H18O3 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | [(1R)-2-oxo-1,2-diphenylethyl] (E)-3-phenylprop-2-enoate |
| SMILES | O=C(/C=C/c1ccccc1)O[C@@H](C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H18O3/c24-21(17-16-18-10-4-1-5-11-18)26-23(20-14-8-3-9-15-20)22(25)19-12-6-2-7-13-19/h1-17,23H/b17-16+/t23-/m1/s1 |
| InChIKey | GMIIBLUETWDOTO-KXKTWFEWSA-N |
| XLogP | 4.87 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|