C23H17NO5 — CID 7852487
[(1S)-2-oxo-1,2-diphenylethyl] (E)-3-(4-nitrophenyl)prop-2-enoate (PubChem CID 7852487) has the molecular formula C23H17NO5 and a molecular weight of 387.39 g/mol. Its IUPAC name is [(1S)-2-oxo-1,2-diphenylethyl] (E)-3-(4-nitrophenyl)prop-2-enoate.
| Compound Name | [(1S)-2-oxo-1,2-diphenylethyl] (E)-3-(4-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7852487 |
| Molecular Formula | C23H17NO5 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | [(1S)-2-oxo-1,2-diphenylethyl] (E)-3-(4-nitrophenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc([N+](=O)[O-])cc1)O[C@H](C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H17NO5/c25-21(16-13-17-11-14-20(15-12-17)24(27)28)29-23(19-9-5-2-6-10-19)22(26)18-7-3-1-4-8-18/h1-16,23H/b16-13+/t23-/m0/s1 |
| InChIKey | LXSGLNRVAUOERO-IGVGMEOHSA-N |
| XLogP | 4.78 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|