C20H15NO4 — CID 7816651
(2R)-2-(4-nitrophenoxy)-1,2-diphenylethanone (PubChem CID 7816651) has the molecular formula C20H15NO4 and a molecular weight of 333.34 g/mol. Its IUPAC name is (2R)-2-(4-nitrophenoxy)-1,2-diphenylethanone.
| Compound Name | (2R)-2-(4-nitrophenoxy)-1,2-diphenylethanone |
|---|---|
| PubChem CID | 7816651 |
| Molecular Formula | C20H15NO4 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | (2R)-2-(4-nitrophenoxy)-1,2-diphenylethanone |
| SMILES | O=C(c1ccccc1)[C@H](Oc1ccc([N+](=O)[O-])cc1)c1ccccc1 |
| InChI | InChI=1S/C20H15NO4/c22-19(15-7-3-1-4-8-15)20(16-9-5-2-6-10-16)25-18-13-11-17(12-14-18)21(23)24/h1-14,20H/t20-/m1/s1 |
| InChIKey | XYYBUSTVSOOBCA-HXUWFJFHSA-N |
| XLogP | 4.60 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|