C25H23NO6 — CID 126190529
[(1S)-1-(4-nitrophenyl)-2-oxo-2-phenylethyl] 4-butoxybenzoate (PubChem CID 126190529) has the molecular formula C25H23NO6 and a molecular weight of 433.46 g/mol. Its IUPAC name is [(1S)-1-(4-nitrophenyl)-2-oxo-2-phenylethyl] 4-butoxybenzoate.
| Compound Name | [(1S)-1-(4-nitrophenyl)-2-oxo-2-phenylethyl] 4-butoxybenzoate |
|---|---|
| PubChem CID | 126190529 |
| Molecular Formula | C25H23NO6 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | [(1S)-1-(4-nitrophenyl)-2-oxo-2-phenylethyl] 4-butoxybenzoate |
| SMILES | CCCCOc1ccc(C(=O)O[C@H](C(=O)c2ccccc2)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C25H23NO6/c1-2-3-17-31-22-15-11-20(12-16-22)25(28)32-24(23(27)18-7-5-4-6-8-18)19-9-13-21(14-10-19)26(29)30/h4-16,24H,2-3,17H2,1H3/t24-/m0/s1 |
| InChIKey | WPKVZQDCZAROKZ-DEOSSOPVSA-N |
| XLogP | 5.55 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|