C30H24N2O7 — CID 126185892
[(1S)-1-(4-nitrophenyl)-2-oxo-2-phenylethyl] 4-[[2-(2-methylphenoxy)acetyl]amino]benzoate (PubChem CID 126185892) has the molecular formula C30H24N2O7 and a molecular weight of 524.53 g/mol. Its IUPAC name is [(1S)-1-(4-nitrophenyl)-2-oxo-2-phenylethyl] 4-[[2-(2-methylphenoxy)acetyl]amino]benzoate.
| Compound Name | [(1S)-1-(4-nitrophenyl)-2-oxo-2-phenylethyl] 4-[[2-(2-methylphenoxy)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126185892 |
| Molecular Formula | C30H24N2O7 |
| Molecular Weight | 524.53 g/mol |
| Exact Mass | 524.16 |
| IUPAC Name | [(1S)-1-(4-nitrophenyl)-2-oxo-2-phenylethyl] 4-[[2-(2-methylphenoxy)acetyl]amino]benzoate |
| SMILES | Cc1ccccc1OCC(=O)Nc1ccc(C(=O)O[C@H](C(=O)c2ccccc2)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C30H24N2O7/c1-20-7-5-6-10-26(20)38-19-27(33)31-24-15-11-23(12-16-24)30(35)39-29(28(34)21-8-3-2-4-9-21)22-13-17-25(18-14-22)32(36)37/h2-18,29H,19H2,1H3,(H,31,33)/t29-/m0/s1 |
| InChIKey | QTTUHMOCMYRMPI-LJAQVGFWSA-N |
| XLogP | 5.70 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.53 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|