C29H23NO6 — CID 126182165
[(1R)-1-(4-nitrophenyl)-2-oxo-2-phenylethyl] 4-[(4-methylphenoxy)methyl]benzoate (PubChem CID 126182165) has the molecular formula C29H23NO6 and a molecular weight of 481.50 g/mol. Its IUPAC name is [(1R)-1-(4-nitrophenyl)-2-oxo-2-phenylethyl] 4-[(4-methylphenoxy)methyl]benzoate.
| Compound Name | [(1R)-1-(4-nitrophenyl)-2-oxo-2-phenylethyl] 4-[(4-methylphenoxy)methyl]benzoate |
|---|---|
| PubChem CID | 126182165 |
| Molecular Formula | C29H23NO6 |
| Molecular Weight | 481.50 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | [(1R)-1-(4-nitrophenyl)-2-oxo-2-phenylethyl] 4-[(4-methylphenoxy)methyl]benzoate |
| SMILES | Cc1ccc(OCc2ccc(C(=O)O[C@@H](C(=O)c3ccccc3)c3ccc([N+](=O)[O-])cc3)cc2)cc1 |
| InChI | InChI=1S/C29H23NO6/c1-20-7-17-26(18-8-20)35-19-21-9-11-24(12-10-21)29(32)36-28(27(31)22-5-3-2-4-6-22)23-13-15-25(16-14-23)30(33)34/h2-18,28H,19H2,1H3/t28-/m1/s1 |
| InChIKey | DDMWKQACKBJIRR-MUUNZHRXSA-N |
| XLogP | 6.26 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.50 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|