C45H28F6N2O10 — CID 126183415
[(1R)-1-(4-nitrophenyl)-2-oxo-2-phenylethyl] 4-[1,1,1,3,3,3-hexafluoro-2-[4-[(1S)-1-(4-nitrophenyl)-2-oxo-2-phenylethoxy]carbonylphenyl]propan-2-yl]benzoate (PubChem CID 126183415) has the molecular formula C45H28F6N2O10 and a molecular weight of 870.71 g/mol. Its IUPAC name is [(1R)-1-(4-nitrophenyl)-2-oxo-2-phenylethyl] 4-[1,1,1,3,3,3-hexafluoro-2-[4-[(1S)-1-(4-nitrophenyl)-2-oxo-2-phenylethoxy]carbonylphenyl]propan-2-yl]benzoate.
| Compound Name | [(1R)-1-(4-nitrophenyl)-2-oxo-2-phenylethyl] 4-[1,1,1,3,3,3-hexafluoro-2-[4-[(1S)-1-(4-nitrophenyl)-2-oxo-2-phenylethoxy]carbonylphenyl]propan-2-yl]benzoate |
|---|---|
| PubChem CID | 126183415 |
| Molecular Formula | C45H28F6N2O10 |
| Molecular Weight | 870.71 g/mol |
| Exact Mass | 870.16 |
| IUPAC Name | [(1R)-1-(4-nitrophenyl)-2-oxo-2-phenylethyl] 4-[1,1,1,3,3,3-hexafluoro-2-[4-[(1S)-1-(4-nitrophenyl)-2-oxo-2-phenylethoxy]carbonylphenyl]propan-2-yl]benzoate |
| SMILES | O=C(O[C@H](C(=O)c1ccccc1)c1ccc([N+](=O)[O-])cc1)c1ccc(C(c2ccc(C(=O)O[C@@H](C(=O)c3ccccc3)c3ccc([N+](=O)[O-])cc3)cc2)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C45H28F6N2O10/c46-44(47,48)43(45(49,50)51,33-19-11-31(12-20-33)41(56)62-39(37(54)27-7-3-1-4-8-27)29-15-23-35(24-16-29)52(58)59)34-21-13-32(14-22-34)42(57)63-40(38(55)28-9-5-2-6-10-28)30-17-25-36(26-18-30)53(60)61/h1-26,39-40H/t39-,40+ |
| InChIKey | BUIRPOIGNZXRQO-LQDDJWCHSA-N |
| XLogP | 10.48 |
| TPSA | 173.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 870.71 |
| LogP ≤ 5 | 10.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|