C17H12F3NO5 — CID 166524069
(4,4,4-trifluoro-1-oxo-1-phenylbutan-2-yl) 4-nitrobenzoate (PubChem CID 166524069) has the molecular formula C17H12F3NO5 and a molecular weight of 367.28 g/mol. Its IUPAC name is (4,4,4-trifluoro-1-oxo-1-phenylbutan-2-yl) 4-nitrobenzoate.
| Compound Name | (4,4,4-trifluoro-1-oxo-1-phenylbutan-2-yl) 4-nitrobenzoate |
|---|---|
| PubChem CID | 166524069 |
| Molecular Formula | C17H12F3NO5 |
| Molecular Weight | 367.28 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | (4,4,4-trifluoro-1-oxo-1-phenylbutan-2-yl) 4-nitrobenzoate |
| SMILES | O=C(OC(CC(F)(F)F)C(=O)c1ccccc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H12F3NO5/c18-17(19,20)10-14(15(22)11-4-2-1-3-5-11)26-16(23)12-6-8-13(9-7-12)21(24)25/h1-9,14H,10H2 |
| InChIKey | PKLALIBLGQVZOL-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.28 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|