C21H14ClNO5 — CID 2936140
(2-oxo-1,2-diphenylethyl) 2-chloro-4-nitrobenzoate (PubChem CID 2936140) has the molecular formula C21H14ClNO5 and a molecular weight of 395.80 g/mol. Its IUPAC name is (2-oxo-1,2-diphenylethyl) 2-chloro-4-nitrobenzoate.
| Compound Name | (2-oxo-1,2-diphenylethyl) 2-chloro-4-nitrobenzoate |
|---|---|
| PubChem CID | 2936140 |
| Molecular Formula | C21H14ClNO5 |
| Molecular Weight | 395.80 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | (2-oxo-1,2-diphenylethyl) 2-chloro-4-nitrobenzoate |
| SMILES | O=C(OC(C(=O)c1ccccc1)c1ccccc1)c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C21H14ClNO5/c22-18-13-16(23(26)27)11-12-17(18)21(25)28-20(15-9-5-2-6-10-15)19(24)14-7-3-1-4-8-14/h1-13,20H |
| InChIKey | JQXFVKJKXVKQRU-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.80 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|