C19H17ClN2O5 — CID 7696638
[(1R)-2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl] 2-chloro-5-nitrobenzoate (PubChem CID 7696638) has the molecular formula C19H17ClN2O5 and a molecular weight of 388.81 g/mol. Its IUPAC name is [(1R)-2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl] 2-chloro-5-nitrobenzoate.
| Compound Name | [(1R)-2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl] 2-chloro-5-nitrobenzoate |
|---|---|
| PubChem CID | 7696638 |
| Molecular Formula | C19H17ClN2O5 |
| Molecular Weight | 388.81 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | [(1R)-2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl] 2-chloro-5-nitrobenzoate |
| SMILES | O=C(O[C@@H](C(=O)N1CCCC1)c1ccccc1)c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C19H17ClN2O5/c20-16-9-8-14(22(25)26)12-15(16)19(24)27-17(13-6-2-1-3-7-13)18(23)21-10-4-5-11-21/h1-3,6-9,12,17H,4-5,10-11H2/t17-/m1/s1 |
| InChIKey | AYWMHSRAJKEWPA-QGZVFWFLSA-N |
| XLogP | 3.77 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.81 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|