C20H18ClF2NO3 — CID 7699910
[(1S)-2-oxo-1-phenyl-2-piperidin-1-ylethyl] 2-chloro-4,5-difluorobenzoate (PubChem CID 7699910) has the molecular formula C20H18ClF2NO3 and a molecular weight of 393.82 g/mol. Its IUPAC name is [(1S)-2-oxo-1-phenyl-2-piperidin-1-ylethyl] 2-chloro-4,5-difluorobenzoate.
| Compound Name | [(1S)-2-oxo-1-phenyl-2-piperidin-1-ylethyl] 2-chloro-4,5-difluorobenzoate |
|---|---|
| PubChem CID | 7699910 |
| Molecular Formula | C20H18ClF2NO3 |
| Molecular Weight | 393.82 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | [(1S)-2-oxo-1-phenyl-2-piperidin-1-ylethyl] 2-chloro-4,5-difluorobenzoate |
| SMILES | O=C(O[C@H](C(=O)N1CCCCC1)c1ccccc1)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C20H18ClF2NO3/c21-15-12-17(23)16(22)11-14(15)20(26)27-18(13-7-3-1-4-8-13)19(25)24-9-5-2-6-10-24/h1,3-4,7-8,11-12,18H,2,5-6,9-10H2/t18-/m0/s1 |
| InChIKey | QGEUPSTZTYPKQL-SFHVURJKSA-N |
| XLogP | 4.53 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.82 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|