C20H21FN2O5S — CID 8638554
[(1R)-2-oxo-1-phenyl-2-piperidin-1-ylethyl] 2-fluoro-5-sulfamoylbenzoate (PubChem CID 8638554) has the molecular formula C20H21FN2O5S and a molecular weight of 420.46 g/mol. Its IUPAC name is [(1R)-2-oxo-1-phenyl-2-piperidin-1-ylethyl] 2-fluoro-5-sulfamoylbenzoate.
| Compound Name | [(1R)-2-oxo-1-phenyl-2-piperidin-1-ylethyl] 2-fluoro-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 8638554 |
| Molecular Formula | C20H21FN2O5S |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | [(1R)-2-oxo-1-phenyl-2-piperidin-1-ylethyl] 2-fluoro-5-sulfamoylbenzoate |
| SMILES | NS(=O)(=O)c1ccc(F)c(C(=O)O[C@@H](C(=O)N2CCCCC2)c2ccccc2)c1 |
| InChI | InChI=1S/C20H21FN2O5S/c21-17-10-9-15(29(22,26)27)13-16(17)20(25)28-18(14-7-3-1-4-8-14)19(24)23-11-5-2-6-12-23/h1,3-4,7-10,13,18H,2,5-6,11-12H2,(H2,22,26,27)/t18-/m1/s1 |
| InChIKey | JOSTWOYVSHWZMT-GOSISDBHSA-N |
| XLogP | 2.38 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |