C19H20N2O5S — CID 27722541
[(1S)-2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl] 4-sulfamoylbenzoate (PubChem CID 27722541) has the molecular formula C19H20N2O5S and a molecular weight of 388.45 g/mol. Its IUPAC name is [(1S)-2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl] 4-sulfamoylbenzoate.
| Compound Name | [(1S)-2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl] 4-sulfamoylbenzoate |
|---|---|
| PubChem CID | 27722541 |
| Molecular Formula | C19H20N2O5S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | [(1S)-2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl] 4-sulfamoylbenzoate |
| SMILES | NS(=O)(=O)c1ccc(C(=O)O[C@H](C(=O)N2CCCC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H20N2O5S/c20-27(24,25)16-10-8-15(9-11-16)19(23)26-17(14-6-2-1-3-7-14)18(22)21-12-4-5-13-21/h1-3,6-11,17H,4-5,12-13H2,(H2,20,24,25)/t17-/m0/s1 |
| InChIKey | RRKFAZBIKNTJNY-KRWDZBQOSA-N |
| XLogP | 1.85 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |