C20H18N2O3 — CID 7705295
[(1S)-2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl] 3-cyanobenzoate (PubChem CID 7705295) has the molecular formula C20H18N2O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is [(1S)-2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl] 3-cyanobenzoate.
| Compound Name | [(1S)-2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl] 3-cyanobenzoate |
|---|---|
| PubChem CID | 7705295 |
| Molecular Formula | C20H18N2O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | [(1S)-2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl] 3-cyanobenzoate |
| SMILES | N#Cc1cccc(C(=O)O[C@H](C(=O)N2CCCC2)c2ccccc2)c1 |
| InChI | InChI=1S/C20H18N2O3/c21-14-15-7-6-10-17(13-15)20(24)25-18(16-8-2-1-3-9-16)19(23)22-11-4-5-12-22/h1-3,6-10,13,18H,4-5,11-12H2/t18-/m0/s1 |
| InChIKey | ZRGSLLZVMWTKSY-SFHVURJKSA-N |
| XLogP | 3.08 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |