C21H20N2O3 — CID 7705315
[(1R)-2-oxo-1-phenyl-2-piperidin-1-ylethyl] 3-cyanobenzoate (PubChem CID 7705315) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is [(1R)-2-oxo-1-phenyl-2-piperidin-1-ylethyl] 3-cyanobenzoate.
| Compound Name | [(1R)-2-oxo-1-phenyl-2-piperidin-1-ylethyl] 3-cyanobenzoate |
|---|---|
| PubChem CID | 7705315 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | [(1R)-2-oxo-1-phenyl-2-piperidin-1-ylethyl] 3-cyanobenzoate |
| SMILES | N#Cc1cccc(C(=O)O[C@@H](C(=O)N2CCCCC2)c2ccccc2)c1 |
| InChI | InChI=1S/C21H20N2O3/c22-15-16-8-7-11-18(14-16)21(25)26-19(17-9-3-1-4-10-17)20(24)23-12-5-2-6-13-23/h1,3-4,7-11,14,19H,2,5-6,12-13H2/t19-/m1/s1 |
| InChIKey | JBJYASPNQHCMQF-LJQANCHMSA-N |
| XLogP | 3.47 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |