C23H27NO6 — CID 18198886
(2-oxo-1-phenyl-2-piperidin-1-ylethyl) 2,4,5-trimethoxybenzoate (PubChem CID 18198886) has the molecular formula C23H27NO6 and a molecular weight of 413.47 g/mol. Its IUPAC name is (2-oxo-1-phenyl-2-piperidin-1-ylethyl) 2,4,5-trimethoxybenzoate.
| Compound Name | (2-oxo-1-phenyl-2-piperidin-1-ylethyl) 2,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 18198886 |
| Molecular Formula | C23H27NO6 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | (2-oxo-1-phenyl-2-piperidin-1-ylethyl) 2,4,5-trimethoxybenzoate |
| SMILES | COc1cc(OC)c(C(=O)OC(C(=O)N2CCCCC2)c2ccccc2)cc1OC |
| InChI | InChI=1S/C23H27NO6/c1-27-18-15-20(29-3)19(28-2)14-17(18)23(26)30-21(16-10-6-4-7-11-16)22(25)24-12-8-5-9-13-24/h4,6-7,10-11,14-15,21H,5,8-9,12-13H2,1-3H3 |
| InChIKey | IXTHIFNTXCJSLN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |