C20H19Cl2NO3 — CID 7699428
[(1S)-2-oxo-1-phenyl-2-piperidin-1-ylethyl] 2,5-dichlorobenzoate (PubChem CID 7699428) has the molecular formula C20H19Cl2NO3 and a molecular weight of 392.28 g/mol. Its IUPAC name is [(1S)-2-oxo-1-phenyl-2-piperidin-1-ylethyl] 2,5-dichlorobenzoate.
| Compound Name | [(1S)-2-oxo-1-phenyl-2-piperidin-1-ylethyl] 2,5-dichlorobenzoate |
|---|---|
| PubChem CID | 7699428 |
| Molecular Formula | C20H19Cl2NO3 |
| Molecular Weight | 392.28 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | [(1S)-2-oxo-1-phenyl-2-piperidin-1-ylethyl] 2,5-dichlorobenzoate |
| SMILES | O=C(O[C@H](C(=O)N1CCCCC1)c1ccccc1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C20H19Cl2NO3/c21-15-9-10-17(22)16(13-15)20(25)26-18(14-7-3-1-4-8-14)19(24)23-11-5-2-6-12-23/h1,3-4,7-10,13,18H,2,5-6,11-12H2/t18-/m0/s1 |
| InChIKey | LDYWTMLWFJTELL-SFHVURJKSA-N |
| XLogP | 4.90 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.28 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |