C17H17ClN2O3 — CID 97014651
[(1S)-2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl] 4-chloro-1H-pyrrole-2-carboxylate (PubChem CID 97014651) has the molecular formula C17H17ClN2O3 and a molecular weight of 332.79 g/mol. Its IUPAC name is [(1S)-2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl] 4-chloro-1H-pyrrole-2-carboxylate.
| Compound Name | [(1S)-2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl] 4-chloro-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 97014651 |
| Molecular Formula | C17H17ClN2O3 |
| Molecular Weight | 332.79 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | [(1S)-2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl] 4-chloro-1H-pyrrole-2-carboxylate |
| SMILES | O=C(O[C@H](C(=O)N1CCCC1)c1ccccc1)c1cc(Cl)c[nH]1 |
| InChI | InChI=1S/C17H17ClN2O3/c18-13-10-14(19-11-13)17(22)23-15(12-6-2-1-3-7-12)16(21)20-8-4-5-9-20/h1-3,6-7,10-11,15,19H,4-5,8-9H2/t15-/m0/s1 |
| InChIKey | SEGNXSZXSGKWQE-HNNXBMFYSA-N |
| XLogP | 3.19 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.79 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |