C20H20ClNO3 — CID 7697298
[(1S)-2-oxo-1-phenyl-2-piperidin-1-ylethyl] 3-chlorobenzoate (PubChem CID 7697298) has the molecular formula C20H20ClNO3 and a molecular weight of 357.84 g/mol. Its IUPAC name is [(1S)-2-oxo-1-phenyl-2-piperidin-1-ylethyl] 3-chlorobenzoate.
| Compound Name | [(1S)-2-oxo-1-phenyl-2-piperidin-1-ylethyl] 3-chlorobenzoate |
|---|---|
| PubChem CID | 7697298 |
| Molecular Formula | C20H20ClNO3 |
| Molecular Weight | 357.84 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | [(1S)-2-oxo-1-phenyl-2-piperidin-1-ylethyl] 3-chlorobenzoate |
| SMILES | O=C(O[C@H](C(=O)N1CCCCC1)c1ccccc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H20ClNO3/c21-17-11-7-10-16(14-17)20(24)25-18(15-8-3-1-4-9-15)19(23)22-12-5-2-6-13-22/h1,3-4,7-11,14,18H,2,5-6,12-13H2/t18-/m0/s1 |
| InChIKey | DMGWAYXMDUSWJD-SFHVURJKSA-N |
| XLogP | 4.25 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.84 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |