C23H26N2O5S — CID 55390054
(2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl) 4-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 55390054) has the molecular formula C23H26N2O5S and a molecular weight of 442.54 g/mol. Its IUPAC name is (2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl) 4-pyrrolidin-1-ylsulfonylbenzoate.
| Compound Name | (2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl) 4-pyrrolidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 55390054 |
| Molecular Formula | C23H26N2O5S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | (2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl) 4-pyrrolidin-1-ylsulfonylbenzoate |
| SMILES | O=C(OC(C(=O)N1CCCC1)c1ccccc1)c1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C23H26N2O5S/c26-22(24-14-4-5-15-24)21(18-8-2-1-3-9-18)30-23(27)19-10-12-20(13-11-19)31(28,29)25-16-6-7-17-25/h1-3,8-13,21H,4-7,14-17H2 |
| InChIKey | QFFRHUVEWMTSRI-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |