C24H26N2O4 — CID 7735914
[(1R)-2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl] 4-[(2-oxopyrrolidin-1-yl)methyl]benzoate (PubChem CID 7735914) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is [(1R)-2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl] 4-[(2-oxopyrrolidin-1-yl)methyl]benzoate.
| Compound Name | [(1R)-2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl] 4-[(2-oxopyrrolidin-1-yl)methyl]benzoate |
|---|---|
| PubChem CID | 7735914 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | [(1R)-2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl] 4-[(2-oxopyrrolidin-1-yl)methyl]benzoate |
| SMILES | O=C(O[C@@H](C(=O)N1CCCC1)c1ccccc1)c1ccc(CN2CCCC2=O)cc1 |
| InChI | InChI=1S/C24H26N2O4/c27-21-9-6-16-26(21)17-18-10-12-20(13-11-18)24(29)30-22(19-7-2-1-3-8-19)23(28)25-14-4-5-15-25/h1-3,7-8,10-13,22H,4-6,9,14-17H2/t22-/m1/s1 |
| InChIKey | MZYAREVWXXRUGQ-JOCHJYFZSA-N |
| XLogP | 3.33 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |