C22H25N3O6S — CID 2675000
[(1R)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 4-piperidin-1-ylsulfonylbenzoate (PubChem CID 2675000) has the molecular formula C22H25N3O6S and a molecular weight of 459.52 g/mol. Its IUPAC name is [(1R)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 4-piperidin-1-ylsulfonylbenzoate.
| Compound Name | [(1R)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 4-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 2675000 |
| Molecular Formula | C22H25N3O6S |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | [(1R)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 4-piperidin-1-ylsulfonylbenzoate |
| SMILES | CNC(=O)NC(=O)[C@H](OC(=O)c1ccc(S(=O)(=O)N2CCCCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H25N3O6S/c1-23-22(28)24-20(26)19(16-8-4-2-5-9-16)31-21(27)17-10-12-18(13-11-17)32(29,30)25-14-6-3-7-15-25/h2,4-5,8-13,19H,3,6-7,14-15H2,1H3,(H2,23,24,26,28)/t19-/m1/s1 |
| InChIKey | ZMLZSNQONWWSRA-LJQANCHMSA-N |
| XLogP | 2.21 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |