C16H15N3O4 — CID 7478175
[(1R)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] pyridine-4-carboxylate (PubChem CID 7478175) has the molecular formula C16H15N3O4 and a molecular weight of 313.31 g/mol. Its IUPAC name is [(1R)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] pyridine-4-carboxylate.
| Compound Name | [(1R)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] pyridine-4-carboxylate |
|---|---|
| PubChem CID | 7478175 |
| Molecular Formula | C16H15N3O4 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | [(1R)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] pyridine-4-carboxylate |
| SMILES | CNC(=O)NC(=O)[C@H](OC(=O)c1ccncc1)c1ccccc1 |
| InChI | InChI=1S/C16H15N3O4/c1-17-16(22)19-14(20)13(11-5-3-2-4-6-11)23-15(21)12-7-9-18-10-8-12/h2-10,13H,1H3,(H2,17,19,20,22)/t13-/m1/s1 |
| InChIKey | NXCVNKJASBEXQW-CYBMUJFWSA-N |
| XLogP | 1.44 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |