C16H14ClN3O4 — CID 8017829
[(1S)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 6-chloropyridine-3-carboxylate (PubChem CID 8017829) has the molecular formula C16H14ClN3O4 and a molecular weight of 347.76 g/mol. Its IUPAC name is [(1S)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 6-chloropyridine-3-carboxylate.
| Compound Name | [(1S)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 6-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 8017829 |
| Molecular Formula | C16H14ClN3O4 |
| Molecular Weight | 347.76 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | [(1S)-2-(methylcarbamoylamino)-2-oxo-1-phenylethyl] 6-chloropyridine-3-carboxylate |
| SMILES | CNC(=O)NC(=O)[C@@H](OC(=O)c1ccc(Cl)nc1)c1ccccc1 |
| InChI | InChI=1S/C16H14ClN3O4/c1-18-16(23)20-14(21)13(10-5-3-2-4-6-10)24-15(22)11-7-8-12(17)19-9-11/h2-9,13H,1H3,(H2,18,20,21,23)/t13-/m0/s1 |
| InChIKey | HCPLTYMMBQNZHP-ZDUSSCGKSA-N |
| XLogP | 2.09 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.76 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|