C20H14ClFN2O3 — CID 2646722
[(1R)-2-(4-fluoroanilino)-2-oxo-1-phenylethyl] 6-chloropyridine-3-carboxylate (PubChem CID 2646722) has the molecular formula C20H14ClFN2O3 and a molecular weight of 384.79 g/mol. Its IUPAC name is [(1R)-2-(4-fluoroanilino)-2-oxo-1-phenylethyl] 6-chloropyridine-3-carboxylate.
| Compound Name | [(1R)-2-(4-fluoroanilino)-2-oxo-1-phenylethyl] 6-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 2646722 |
| Molecular Formula | C20H14ClFN2O3 |
| Molecular Weight | 384.79 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | [(1R)-2-(4-fluoroanilino)-2-oxo-1-phenylethyl] 6-chloropyridine-3-carboxylate |
| SMILES | O=C(O[C@@H](C(=O)Nc1ccc(F)cc1)c1ccccc1)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C20H14ClFN2O3/c21-17-11-6-14(12-23-17)20(26)27-18(13-4-2-1-3-5-13)19(25)24-16-9-7-15(22)8-10-16/h1-12,18H,(H,24,25)/t18-/m1/s1 |
| InChIKey | YTWGREJQICUUNG-GOSISDBHSA-N |
| XLogP | 4.41 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.79 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|