C27H27BFNO5 — CID 154573595
[2-oxo-1-phenyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]ethyl] 4-fluorobenzoate (PubChem CID 154573595) has the molecular formula C27H27BFNO5 and a molecular weight of 475.33 g/mol. Its IUPAC name is [2-oxo-1-phenyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]ethyl] 4-fluorobenzoate.
| Compound Name | [2-oxo-1-phenyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]ethyl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 154573595 |
| Molecular Formula | C27H27BFNO5 |
| Molecular Weight | 475.33 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | [2-oxo-1-phenyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]ethyl] 4-fluorobenzoate |
| SMILES | CC1(C)OB(c2ccc(NC(=O)C(OC(=O)c3ccc(F)cc3)c3ccccc3)cc2)OC1(C)C |
| InChI | InChI=1S/C27H27BFNO5/c1-26(2)27(3,4)35-28(34-26)20-12-16-22(17-13-20)30-24(31)23(18-8-6-5-7-9-18)33-25(32)19-10-14-21(29)15-11-19/h5-17,23H,1-4H3,(H,30,31) |
| InChIKey | DYUQRRCBTUPXJH-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.33 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|