C22H24BF2NO5 — CID 156646562
[1-(3,5-difluorophenyl)-2-oxo-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]ethyl] acetate (PubChem CID 156646562) has the molecular formula C22H24BF2NO5 and a molecular weight of 431.24 g/mol. Its IUPAC name is [1-(3,5-difluorophenyl)-2-oxo-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]ethyl] acetate.
| Compound Name | [1-(3,5-difluorophenyl)-2-oxo-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]ethyl] acetate |
|---|---|
| PubChem CID | 156646562 |
| Molecular Formula | C22H24BF2NO5 |
| Molecular Weight | 431.24 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | [1-(3,5-difluorophenyl)-2-oxo-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]ethyl] acetate |
| SMILES | CC(=O)OC(C(=O)Nc1ccc(B2OC(C)(C)C(C)(C)O2)cc1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C22H24BF2NO5/c1-13(27)29-19(14-10-16(24)12-17(25)11-14)20(28)26-18-8-6-15(7-9-18)23-30-21(2,3)22(4,5)31-23/h6-12,19H,1-5H3,(H,26,28) |
| InChIKey | SVOKHUSDYVFNCM-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.24 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|