C21H27BN2O3 — CID 139592799
1-(3,4-dimethylphenyl)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea (PubChem CID 139592799) has the molecular formula C21H27BN2O3 and a molecular weight of 366.27 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea.
| Compound Name | 1-(3,4-dimethylphenyl)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 139592799 |
| Molecular Formula | C21H27BN2O3 |
| Molecular Weight | 366.27 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea |
| SMILES | Cc1ccc(NC(=O)Nc2ccc(B3OC(C)(C)C(C)(C)O3)cc2)cc1C |
| InChI | InChI=1S/C21H27BN2O3/c1-14-7-10-18(13-15(14)2)24-19(25)23-17-11-8-16(9-12-17)22-26-20(3,4)21(5,6)27-22/h7-13H,1-6H3,(H2,23,24,25) |
| InChIKey | IZOSKIUVSCKIPY-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.27 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|