C20H25BN2O3S — CID 162476624
1-(4-methylsulfanylphenyl)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea (PubChem CID 162476624) has the molecular formula C20H25BN2O3S and a molecular weight of 384.31 g/mol. Its IUPAC name is 1-(4-methylsulfanylphenyl)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea.
| Compound Name | 1-(4-methylsulfanylphenyl)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 162476624 |
| Molecular Formula | C20H25BN2O3S |
| Molecular Weight | 384.31 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 1-(4-methylsulfanylphenyl)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea |
| SMILES | CSc1ccc(NC(=O)Nc2ccc(B3OC(C)(C)C(C)(C)O3)cc2)cc1 |
| InChI | InChI=1S/C20H25BN2O3S/c1-19(2)20(3,4)26-21(25-19)14-6-8-15(9-7-14)22-18(24)23-16-10-12-17(27-5)13-11-16/h6-13H,1-5H3,(H2,22,23,24) |
| InChIKey | YUAJMHSVBNYCBF-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.31 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|