C39H46B2N4O6 — CID 132608953
1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-[4-[[4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamoylamino]phenyl]methyl]phenyl]urea (PubChem CID 132608953) has the molecular formula C39H46B2N4O6 and a molecular weight of 688.44 g/mol. Its IUPAC name is 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-[4-[[4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamoylamino]phenyl]methyl]phenyl]urea.
| Compound Name | 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-[4-[[4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamoylamino]phenyl]methyl]phenyl]urea |
|---|---|
| PubChem CID | 132608953 |
| Molecular Formula | C39H46B2N4O6 |
| Molecular Weight | 688.44 g/mol |
| Exact Mass | 688.36 |
| IUPAC Name | 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-[4-[[4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamoylamino]phenyl]methyl]phenyl]urea |
| SMILES | CC1(C)OB(c2ccc(NC(=O)Nc3ccc(Cc4ccc(NC(=O)Nc5ccc(B6OC(C)(C)C(C)(C)O6)cc5)cc4)cc3)cc2)OC1(C)C |
| InChI | InChI=1S/C39H46B2N4O6/c1-36(2)37(3,4)49-40(48-36)28-13-21-32(22-14-28)44-34(46)42-30-17-9-26(10-18-30)25-27-11-19-31(20-12-27)43-35(47)45-33-23-15-29(16-24-33)41-50-38(5,6)39(7,8)51-41/h9-24H,25H2,1-8H3,(H2,42,44,46)(H2,43,45,47) |
| InChIKey | LMLACMFXVPKPLD-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 119.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.44 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|