C18H24BNO6 — CID 168570197
dimethyl (E)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]but-2-enedioate (PubChem CID 168570197) has the molecular formula C18H24BNO6 and a molecular weight of 361.20 g/mol. Its IUPAC name is dimethyl (E)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]but-2-enedioate |
|---|---|
| PubChem CID | 168570197 |
| Molecular Formula | C18H24BNO6 |
| Molecular Weight | 361.20 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | dimethyl (E)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1ccc(B2OC(C)(C)C(C)(C)O2)cc1)C(=O)OC |
| InChI | InChI=1S/C18H24BNO6/c1-17(2)18(3,4)26-19(25-17)12-7-9-13(10-8-12)20-14(16(22)24-6)11-15(21)23-5/h7-11,20H,1-6H3/b14-11+ |
| InChIKey | KBSFRUKYFIYMED-SDNWHVSQSA-N |
| XLogP | 1.63 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.20 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|