C12H14N2O6S — CID 168565932
dimethyl (E)-2-(4-sulfamoylanilino)but-2-enedioate (PubChem CID 168565932) has the molecular formula C12H14N2O6S and a molecular weight of 314.32 g/mol. Its IUPAC name is dimethyl (E)-2-(4-sulfamoylanilino)but-2-enedioate.
| Compound Name | dimethyl (E)-2-(4-sulfamoylanilino)but-2-enedioate |
|---|---|
| PubChem CID | 168565932 |
| Molecular Formula | C12H14N2O6S |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | dimethyl (E)-2-(4-sulfamoylanilino)but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1ccc(S(N)(=O)=O)cc1)C(=O)OC |
| InChI | InChI=1S/C12H14N2O6S/c1-19-11(15)7-10(12(16)20-2)14-8-3-5-9(6-4-8)21(13,17)18/h3-7,14H,1-2H3,(H2,13,17,18)/b10-7+ |
| InChIKey | DEXABKZVYFKRCP-JXMROGBWSA-N |
| XLogP | -0.02 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|