C18H24N2O7S — CID 168570463
dimethyl (E)-2-[4-(2,6-dimethylmorpholin-4-yl)sulfonylanilino]but-2-enedioate (PubChem CID 168570463) has the molecular formula C18H24N2O7S and a molecular weight of 412.46 g/mol. Its IUPAC name is dimethyl (E)-2-[4-(2,6-dimethylmorpholin-4-yl)sulfonylanilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[4-(2,6-dimethylmorpholin-4-yl)sulfonylanilino]but-2-enedioate |
|---|---|
| PubChem CID | 168570463 |
| Molecular Formula | C18H24N2O7S |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | dimethyl (E)-2-[4-(2,6-dimethylmorpholin-4-yl)sulfonylanilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1ccc(S(=O)(=O)N2CC(C)OC(C)C2)cc1)C(=O)OC |
| InChI | InChI=1S/C18H24N2O7S/c1-12-10-20(11-13(2)27-12)28(23,24)15-7-5-14(6-8-15)19-16(18(22)26-4)9-17(21)25-3/h5-9,12-13,19H,10-11H2,1-4H3/b16-9+ |
| InChIKey | CRRQDQLBSLBBOZ-CXUHLZMHSA-N |
| XLogP | 1.13 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|